C13H16FNO2 — CID 117201234
2-(1-ethyl-5-fluoro-2,3-dihydroindol-2-yl)propanoic acid (PubChem CID 117201234) has the molecular formula C13H16FNO2 and a molecular weight of 237.27 g/mol. Its IUPAC name is 2-(1-ethyl-5-fluoro-2,3-dihydroindol-2-yl)propanoic acid.
| Compound Name | 2-(1-ethyl-5-fluoro-2,3-dihydroindol-2-yl)propanoic acid |
|---|---|
| PubChem CID | 117201234 |
| Molecular Formula | C13H16FNO2 |
| Molecular Weight | 237.27 g/mol |
| Exact Mass | 237.12 |
| IUPAC Name | 2-(1-ethyl-5-fluoro-2,3-dihydroindol-2-yl)propanoic acid |
| SMILES | CCN1c2ccc(F)cc2CC1C(C)C(=O)O |
| InChI | InChI=1S/C13H16FNO2/c1-3-15-11-5-4-10(14)6-9(11)7-12(15)8(2)13(16)17/h4-6,8,12H,3,7H2,1-2H3,(H,16,17) |
| InChIKey | MXDQXFCFOWUASY-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.27 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |