C12H16FNO — CID 117198605
1-(4-fluoro-1-methyl-2,3-dihydroindol-2-yl)propan-2-ol (PubChem CID 117198605) has the molecular formula C12H16FNO and a molecular weight of 209.26 g/mol. Its IUPAC name is 1-(4-fluoro-1-methyl-2,3-dihydroindol-2-yl)propan-2-ol.
| Compound Name | 1-(4-fluoro-1-methyl-2,3-dihydroindol-2-yl)propan-2-ol |
|---|---|
| PubChem CID | 117198605 |
| Molecular Formula | C12H16FNO |
| Molecular Weight | 209.26 g/mol |
| Exact Mass | 209.12 |
| IUPAC Name | 1-(4-fluoro-1-methyl-2,3-dihydroindol-2-yl)propan-2-ol |
| SMILES | CC(O)CC1Cc2c(F)cccc2N1C |
| InChI | InChI=1S/C12H16FNO/c1-8(15)6-9-7-10-11(13)4-3-5-12(10)14(9)2/h3-5,8-9,15H,6-7H2,1-2H3 |
| InChIKey | DDKUDRVIWILDDQ-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.26 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |