C12H17NO — CID 117202869
1-(1,2-dimethyl-2,3-dihydroindol-4-yl)ethanol (PubChem CID 117202869) has the molecular formula C12H17NO and a molecular weight of 191.27 g/mol. Its IUPAC name is 1-(1,2-dimethyl-2,3-dihydroindol-4-yl)ethanol.
| Compound Name | 1-(1,2-dimethyl-2,3-dihydroindol-4-yl)ethanol |
|---|---|
| PubChem CID | 117202869 |
| Molecular Formula | C12H17NO |
| Molecular Weight | 191.27 g/mol |
| Exact Mass | 191.13 |
| IUPAC Name | 1-(1,2-dimethyl-2,3-dihydroindol-4-yl)ethanol |
| SMILES | CC(O)c1cccc2c1CC(C)N2C |
| InChI | InChI=1S/C12H17NO/c1-8-7-11-10(9(2)14)5-4-6-12(11)13(8)3/h4-6,8-9,14H,7H2,1-3H3 |
| InChIKey | MZXKBBLUJWXGPX-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.27 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |