C12H17NO2 — CID 117199118
1-ethyl-2-(2-hydroxyethyl)-2,3-dihydroindol-4-ol (PubChem CID 117199118) has the molecular formula C12H17NO2 and a molecular weight of 207.27 g/mol. Its IUPAC name is 1-ethyl-2-(2-hydroxyethyl)-2,3-dihydroindol-4-ol.
| Compound Name | 1-ethyl-2-(2-hydroxyethyl)-2,3-dihydroindol-4-ol |
|---|---|
| PubChem CID | 117199118 |
| Molecular Formula | C12H17NO2 |
| Molecular Weight | 207.27 g/mol |
| Exact Mass | 207.13 |
| IUPAC Name | 1-ethyl-2-(2-hydroxyethyl)-2,3-dihydroindol-4-ol |
| SMILES | CCN1c2cccc(O)c2CC1CCO |
| InChI | InChI=1S/C12H17NO2/c1-2-13-9(6-7-14)8-10-11(13)4-3-5-12(10)15/h3-5,9,14-15H,2,6-8H2,1H3 |
| InChIKey | AVMCWFXIVLKEQB-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.27 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |