C9H10BrNS — CID 84631089
5-bromo-4-methyl-2,3-dihydro-1,4-benzothiazine (PubChem CID 84631089) has the molecular formula C9H10BrNS and a molecular weight of 244.16 g/mol. Its IUPAC name is 5-bromo-4-methyl-2,3-dihydro-1,4-benzothiazine.
| Compound Name | 5-bromo-4-methyl-2,3-dihydro-1,4-benzothiazine |
|---|---|
| PubChem CID | 84631089 |
| Molecular Formula | C9H10BrNS |
| Molecular Weight | 244.16 g/mol |
| Exact Mass | 242.97 |
| IUPAC Name | 5-bromo-4-methyl-2,3-dihydro-1,4-benzothiazine |
| SMILES | CN1CCSc2cccc(Br)c21 |
| InChI | InChI=1S/C9H10BrNS/c1-11-5-6-12-8-4-2-3-7(10)9(8)11/h2-4H,5-6H2,1H3 |
| InChIKey | MOJGMSVHVRXFIE-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.16 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |