C10H13NOS — CID 84619364
5-methoxy-8-methyl-3,4-dihydro-2H-1,4-benzothiazine (PubChem CID 84619364) has the molecular formula C10H13NOS and a molecular weight of 195.29 g/mol. Its IUPAC name is 5-methoxy-8-methyl-3,4-dihydro-2H-1,4-benzothiazine.
| Compound Name | 5-methoxy-8-methyl-3,4-dihydro-2H-1,4-benzothiazine |
|---|---|
| PubChem CID | 84619364 |
| Molecular Formula | C10H13NOS |
| Molecular Weight | 195.29 g/mol |
| Exact Mass | 195.07 |
| IUPAC Name | 5-methoxy-8-methyl-3,4-dihydro-2H-1,4-benzothiazine |
| SMILES | COc1ccc(C)c2c1NCCS2 |
| InChI | InChI=1S/C10H13NOS/c1-7-3-4-8(12-2)9-10(7)13-6-5-11-9/h3-4,11H,5-6H2,1-2H3 |
| InChIKey | NIROFMODNLUEHC-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.29 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |