C14H18N2O2 — CID 84632325
7-methoxy-4-methylspiro[1H-indole-3,4'-piperidine]-2-one (PubChem CID 84632325) has the molecular formula C14H18N2O2 and a molecular weight of 246.31 g/mol. Its IUPAC name is 7-methoxy-4-methylspiro[1H-indole-3,4'-piperidine]-2-one.
| Compound Name | 7-methoxy-4-methylspiro[1H-indole-3,4'-piperidine]-2-one |
|---|---|
| PubChem CID | 84632325 |
| Molecular Formula | C14H18N2O2 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.14 |
| IUPAC Name | 7-methoxy-4-methylspiro[1H-indole-3,4'-piperidine]-2-one |
| SMILES | COc1ccc(C)c2c1NC(=O)C21CCNCC1 |
| InChI | InChI=1S/C14H18N2O2/c1-9-3-4-10(18-2)12-11(9)14(13(17)16-12)5-7-15-8-6-14/h3-4,15H,5-8H2,1-2H3,(H,16,17) |
| InChIKey | RFMBIIMDUAZVDQ-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |