C12H17NOS — CID 84624461
5-methoxy-2,2,8-trimethyl-3,4-dihydro-1,4-benzothiazine (PubChem CID 84624461) has the molecular formula C12H17NOS and a molecular weight of 223.34 g/mol. Its IUPAC name is 5-methoxy-2,2,8-trimethyl-3,4-dihydro-1,4-benzothiazine.
| Compound Name | 5-methoxy-2,2,8-trimethyl-3,4-dihydro-1,4-benzothiazine |
|---|---|
| PubChem CID | 84624461 |
| Molecular Formula | C12H17NOS |
| Molecular Weight | 223.34 g/mol |
| Exact Mass | 223.10 |
| IUPAC Name | 5-methoxy-2,2,8-trimethyl-3,4-dihydro-1,4-benzothiazine |
| SMILES | COc1ccc(C)c2c1NCC(C)(C)S2 |
| InChI | InChI=1S/C12H17NOS/c1-8-5-6-9(14-4)10-11(8)15-12(2,3)7-13-10/h5-6,13H,7H2,1-4H3 |
| InChIKey | ZRTHBMZQKVPRLX-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.34 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |