C13H12OS2 — CID 10857834
7-methoxy-2,3-dihydrobenzo[h][1,4]benzodithiine (PubChem CID 10857834) has the molecular formula C13H12OS2 and a molecular weight of 248.37 g/mol. Its IUPAC name is 7-methoxy-2,3-dihydrobenzo[h][1,4]benzodithiine.
| Compound Name | 7-methoxy-2,3-dihydrobenzo[h][1,4]benzodithiine |
|---|---|
| PubChem CID | 10857834 |
| Molecular Formula | C13H12OS2 |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.03 |
| IUPAC Name | 7-methoxy-2,3-dihydrobenzo[h][1,4]benzodithiine |
| SMILES | COc1cccc2c3c(ccc12)SCCS3 |
| InChI | InChI=1S/C13H12OS2/c1-14-11-4-2-3-10-9(11)5-6-12-13(10)16-8-7-15-12/h2-6H,7-8H2,1H3 |
| InChIKey | KQDFFAQSJLRYTL-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |