C10H8F4O — CID 86255415
2,2,3,3-tetrafluoro-4-methoxy-1H-indene (PubChem CID 86255415) has the molecular formula C10H8F4O and a molecular weight of 220.16 g/mol. Its IUPAC name is 2,2,3,3-tetrafluoro-4-methoxy-1H-indene.
| Compound Name | 2,2,3,3-tetrafluoro-4-methoxy-1H-indene |
|---|---|
| PubChem CID | 86255415 |
| Molecular Formula | C10H8F4O |
| Molecular Weight | 220.16 g/mol |
| Exact Mass | 220.05 |
| IUPAC Name | 2,2,3,3-tetrafluoro-4-methoxy-1H-indene |
| SMILES | COc1cccc2c1C(F)(F)C(F)(F)C2 |
| InChI | InChI=1S/C10H8F4O/c1-15-7-4-2-3-6-5-9(11,12)10(13,14)8(6)7/h2-4H,5H2,1H3 |
| InChIKey | MBYAEBVRZMDBFE-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.16 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|