C13H17NO2 — CID 175048904
(3S)-4-methoxyspiro[1,2-dihydroindene-3,5'-pyrrolidine]-2'-ol (PubChem CID 175048904) has the molecular formula C13H17NO2 and a molecular weight of 219.28 g/mol. Its IUPAC name is (3S)-4-methoxyspiro[1,2-dihydroindene-3,5'-pyrrolidine]-2'-ol.
| Compound Name | (3S)-4-methoxyspiro[1,2-dihydroindene-3,5'-pyrrolidine]-2'-ol |
|---|---|
| PubChem CID | 175048904 |
| Molecular Formula | C13H17NO2 |
| Molecular Weight | 219.28 g/mol |
| Exact Mass | 219.13 |
| IUPAC Name | (3S)-4-methoxyspiro[1,2-dihydroindene-3,5'-pyrrolidine]-2'-ol |
| SMILES | COc1cccc2c1[C@]1(CC2)CCC(O)N1 |
| InChI | InChI=1S/C13H17NO2/c1-16-10-4-2-3-9-5-7-13(12(9)10)8-6-11(15)14-13/h2-4,11,14-15H,5-8H2,1H3/t11?,13-/m0/s1 |
| InChIKey | SPGJJPOADWSHQM-YUZLPWPTSA-N |
| XLogP | 1.54 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.28 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |