C18H23NO2Si — CID 138454515
(1,6-dimethoxy-5,10-dihydrobenzo[g]isoquinolin-3-yl)-trimethylsilane (PubChem CID 138454515) has the molecular formula C18H23NO2Si and a molecular weight of 313.47 g/mol. Its IUPAC name is (1,6-dimethoxy-5,10-dihydrobenzo[g]isoquinolin-3-yl)-trimethylsilane.
| Compound Name | (1,6-dimethoxy-5,10-dihydrobenzo[g]isoquinolin-3-yl)-trimethylsilane |
|---|---|
| PubChem CID | 138454515 |
| Molecular Formula | C18H23NO2Si |
| Molecular Weight | 313.47 g/mol |
| Exact Mass | 313.15 |
| IUPAC Name | (1,6-dimethoxy-5,10-dihydrobenzo[g]isoquinolin-3-yl)-trimethylsilane |
| SMILES | COc1cccc2c1Cc1cc([Si](C)(C)C)nc(OC)c1C2 |
| InChI | InChI=1S/C18H23NO2Si/c1-20-16-8-6-7-12-9-15-13(10-14(12)16)11-17(22(3,4)5)19-18(15)21-2/h6-8,11H,9-10H2,1-5H3 |
| InChIKey | LEWIWWNQPZMNGK-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.47 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|