C10H11IN2 — CID 625407
3-iodo-1,8-diazatricyclo[6.2.2.02,7]dodeca-2(7),3,5-triene (PubChem CID 625407) has the molecular formula C10H11IN2 and a molecular weight of 286.12 g/mol. Its IUPAC name is 3-iodo-1,8-diazatricyclo[6.2.2.02,7]dodeca-2(7),3,5-triene.
| Compound Name | 3-iodo-1,8-diazatricyclo[6.2.2.02,7]dodeca-2(7),3,5-triene |
|---|---|
| PubChem CID | 625407 |
| Molecular Formula | C10H11IN2 |
| Molecular Weight | 286.12 g/mol |
| Exact Mass | 286.00 |
| IUPAC Name | 3-iodo-1,8-diazatricyclo[6.2.2.02,7]dodeca-2(7),3,5-triene |
| SMILES | Ic1cccc2c1N1CCN2CC1 |
| InChI | InChI=1S/C10H11IN2/c11-8-2-1-3-9-10(8)13-6-4-12(9)5-7-13/h1-3H,4-7H2 |
| InChIKey | XAJAZEGOKNWPLB-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.12 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|