C24H32N2O — CID 10451433
(3R,4R)-1-[(3-methylphenyl)methyl]-3-(4-phenylpiperidin-1-yl)piperidin-4-ol (PubChem CID 10451433) has the molecular formula C24H32N2O and a molecular weight of 364.53 g/mol. Its IUPAC name is (3R,4R)-1-[(3-methylphenyl)methyl]-3-(4-phenylpiperidin-1-yl)piperidin-4-ol.
| Compound Name | (3R,4R)-1-[(3-methylphenyl)methyl]-3-(4-phenylpiperidin-1-yl)piperidin-4-ol |
|---|---|
| PubChem CID | 10451433 |
| Molecular Formula | C24H32N2O |
| Molecular Weight | 364.53 g/mol |
| Exact Mass | 364.25 |
| IUPAC Name | (3R,4R)-1-[(3-methylphenyl)methyl]-3-(4-phenylpiperidin-1-yl)piperidin-4-ol |
| SMILES | Cc1cccc(CN2CC[C@@H](O)[C@H](N3CCC(c4ccccc4)CC3)C2)c1 |
| InChI | InChI=1S/C24H32N2O/c1-19-6-5-7-20(16-19)17-25-13-12-24(27)23(18-25)26-14-10-22(11-15-26)21-8-3-2-4-9-21/h2-9,16,22-24,27H,10-15,17-18H2,1H3/t23-,24-/m1/s1 |
| InChIKey | AOZCHKRVWHUCEP-DNQXCXABSA-N |
| XLogP | 3.81 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.53 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |