C15H13FN4O2 — CID 141029275
methyl 1-(4-azidocyclopenten-1-yl)-5-fluoroindole-3-carboxylate (PubChem CID 141029275) has the molecular formula C15H13FN4O2 and a molecular weight of 300.29 g/mol. Its IUPAC name is methyl 1-(4-azidocyclopenten-1-yl)-5-fluoroindole-3-carboxylate.
| Compound Name | methyl 1-(4-azidocyclopenten-1-yl)-5-fluoroindole-3-carboxylate |
|---|---|
| PubChem CID | 141029275 |
| Molecular Formula | C15H13FN4O2 |
| Molecular Weight | 300.29 g/mol |
| Exact Mass | 300.10 |
| IUPAC Name | methyl 1-(4-azidocyclopenten-1-yl)-5-fluoroindole-3-carboxylate |
| SMILES | COC(=O)c1cn(C2=CCC(N=[N+]=[N-])C2)c2ccc(F)cc12 |
| InChI | InChI=1S/C15H13FN4O2/c1-22-15(21)13-8-20(11-4-3-10(7-11)18-19-17)14-5-2-9(16)6-12(13)14/h2,4-6,8,10H,3,7H2,1H3 |
| InChIKey | DTSAUZKGELVBQQ-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 79.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.29 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|