C17H14FNO6S — CID 122217603
dimethyl 6-fluoro-9-methylsulfonylcarbazole-2,3-dicarboxylate (PubChem CID 122217603) has the molecular formula C17H14FNO6S and a molecular weight of 379.37 g/mol. Its IUPAC name is dimethyl 6-fluoro-9-methylsulfonylcarbazole-2,3-dicarboxylate.
| Compound Name | dimethyl 6-fluoro-9-methylsulfonylcarbazole-2,3-dicarboxylate |
|---|---|
| PubChem CID | 122217603 |
| Molecular Formula | C17H14FNO6S |
| Molecular Weight | 379.37 g/mol |
| Exact Mass | 379.05 |
| IUPAC Name | dimethyl 6-fluoro-9-methylsulfonylcarbazole-2,3-dicarboxylate |
| SMILES | COC(=O)c1cc2c3cc(F)ccc3n(S(C)(=O)=O)c2cc1C(=O)OC |
| InChI | InChI=1S/C17H14FNO6S/c1-24-16(20)12-7-11-10-6-9(18)4-5-14(10)19(26(3,22)23)15(11)8-13(12)17(21)25-2/h4-8H,1-3H3 |
| InChIKey | VQXTWMGBEOJQAI-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 91.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.37 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |