C8H14N4O3 — CID 18643573
ethyl (3S,4S)-4-azido-3-hydroxypiperidine-1-carboxylate (PubChem CID 18643573) has the molecular formula C8H14N4O3 and a molecular weight of 214.22 g/mol. Its IUPAC name is ethyl (3S,4S)-4-azido-3-hydroxypiperidine-1-carboxylate.
| Compound Name | ethyl (3S,4S)-4-azido-3-hydroxypiperidine-1-carboxylate |
|---|---|
| PubChem CID | 18643573 |
| Molecular Formula | C8H14N4O3 |
| Molecular Weight | 214.22 g/mol |
| Exact Mass | 214.11 |
| IUPAC Name | ethyl (3S,4S)-4-azido-3-hydroxypiperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CC[C@H](N=[N+]=[N-])[C@@H](O)C1 |
| InChI | InChI=1S/C8H14N4O3/c1-2-15-8(14)12-4-3-6(10-11-9)7(13)5-12/h6-7,13H,2-5H2,1H3/t6-,7-/m0/s1 |
| InChIKey | BUBAUGPFPFBLQM-BQBZGAKWSA-N |
| XLogP | 0.89 |
| TPSA | 98.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.22 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|