C12H18Br6 — CID 76964962
(1S,2S,3S,4S,5S,6S)-1,2,3,4,5,6-hexabromocyclododecane (PubChem CID 76964962) has the molecular formula C12H18Br6 and a molecular weight of 641.70 g/mol. Its IUPAC name is (1S,2S,3S,4S,5S,6S)-1,2,3,4,5,6-hexabromocyclododecane.
| Compound Name | (1S,2S,3S,4S,5S,6S)-1,2,3,4,5,6-hexabromocyclododecane |
|---|---|
| PubChem CID | 76964962 |
| Molecular Formula | C12H18Br6 |
| Molecular Weight | 641.70 g/mol |
| Exact Mass | 635.65 |
| IUPAC Name | (1S,2S,3S,4S,5S,6S)-1,2,3,4,5,6-hexabromocyclododecane |
| SMILES | Br[C@@H]1[C@@H](Br)[C@@H](Br)[C@@H](Br)CCCCCC[C@H](Br)[C@@H]1Br |
| InChI | InChI=1S/C12H18Br6/c13-7-5-3-1-2-4-6-8(14)10(16)12(18)11(17)9(7)15/h7-12H,1-6H2/t7-,8-,9-,10-,11-,12-/m0/s1 |
| InChIKey | DPLVBOHFTBKOLX-ZNSCXOEOSA-N |
| XLogP | 6.92 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.70 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|