C7H10F2O — CID 118208262
2,3-difluorocyclohexane-1-carbaldehyde (PubChem CID 118208262) has the molecular formula C7H10F2O and a molecular weight of 148.15 g/mol. Its IUPAC name is 2,3-difluorocyclohexane-1-carbaldehyde.
| Compound Name | 2,3-difluorocyclohexane-1-carbaldehyde |
|---|---|
| PubChem CID | 118208262 |
| Molecular Formula | C7H10F2O |
| Molecular Weight | 148.15 g/mol |
| Exact Mass | 148.07 |
| IUPAC Name | 2,3-difluorocyclohexane-1-carbaldehyde |
| SMILES | O=CC1CCCC(F)C1F |
| InChI | InChI=1S/C7H10F2O/c8-6-3-1-2-5(4-10)7(6)9/h4-7H,1-3H2 |
| InChIKey | VOSCPNLLTNPTDW-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.15 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|