About 1-(2,3-difluorocyclobutyl)oxy-2,3-difluorocyclobutane
1-(2,3-difluorocyclobutyl)oxy-2,3-difluorocyclobutane (PubChem CID 175592025) has the molecular formula C8H10F4O
and a molecular weight of 198.16 g/mol. Its IUPAC name is 1-(2,3-difluorocyclobutyl)oxy-2,3-difluorocyclobutane.
Analyze 1-(2,3-difluorocyclobutyl)oxy-2,3-difluorocyclobutane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,3-difluorocyclobutyl)oxy-2,3-difluorocyclobutane?
The IUPAC name of 1-(2,3-difluorocyclobutyl)oxy-2,3-difluorocyclobutane (CID 175592025) is 1-(2,3-difluorocyclobutyl)oxy-2,3-difluorocyclobutane.
What is the SMILES notation for 1-(2,3-difluorocyclobutyl)oxy-2,3-difluorocyclobutane?
The canonical SMILES for 1-(2,3-difluorocyclobutyl)oxy-2,3-difluorocyclobutane is FC1CC(OC2CC(F)C2F)C1F.
What is the InChIKey of 1-(2,3-difluorocyclobutyl)oxy-2,3-difluorocyclobutane?
The InChIKey is SIBDSHZOCZTSBD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10F4O/c9-3-1-5(7(3)11)13-6-2-4(10)8(6)12/h3-8H,1-2H2.
What are the key properties of 1-(2,3-difluorocyclobutyl)oxy-2,3-difluorocyclobutane?
1-(2,3-difluorocyclobutyl)oxy-2,3-difluorocyclobutane has a molecular weight of 198.16 g/mol, XLogP of 1.90, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,3-difluorocyclobutyl)oxy-2,3-difluorocyclobutane is sourced from PubChem (CID 175592025), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).