About 1-(2,3-difluorocyclopropyl)oxy-2,3-difluorocyclopropane
1-(2,3-difluorocyclopropyl)oxy-2,3-difluorocyclopropane (PubChem CID 121379767) has the molecular formula C6H6F4O
and a molecular weight of 170.11 g/mol. Its IUPAC name is 1-(2,3-difluorocyclopropyl)oxy-2,3-difluorocyclopropane.
Analyze 1-(2,3-difluorocyclopropyl)oxy-2,3-difluorocyclopropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,3-difluorocyclopropyl)oxy-2,3-difluorocyclopropane?
The IUPAC name of 1-(2,3-difluorocyclopropyl)oxy-2,3-difluorocyclopropane (CID 121379767) is 1-(2,3-difluorocyclopropyl)oxy-2,3-difluorocyclopropane.
What is the SMILES notation for 1-(2,3-difluorocyclopropyl)oxy-2,3-difluorocyclopropane?
The canonical SMILES for 1-(2,3-difluorocyclopropyl)oxy-2,3-difluorocyclopropane is FC1C(F)C1OC1C(F)C1F.
What is the InChIKey of 1-(2,3-difluorocyclopropyl)oxy-2,3-difluorocyclopropane?
The InChIKey is HZZJQSXMWWWNAY-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6F4O/c7-1-2(8)5(1)11-6-3(9)4(6)10/h1-6H.
What are the key properties of 1-(2,3-difluorocyclopropyl)oxy-2,3-difluorocyclopropane?
1-(2,3-difluorocyclopropyl)oxy-2,3-difluorocyclopropane has a molecular weight of 170.11 g/mol, XLogP of 1.12, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,3-difluorocyclopropyl)oxy-2,3-difluorocyclopropane is sourced from PubChem (CID 121379767), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).