About dimethylphosphane;1-fluoro-4-(4-fluorocyclohexyl)oxycyclohexane
dimethylphosphane;1-fluoro-4-(4-fluorocyclohexyl)oxycyclohexane (PubChem CID 139328560) has the molecular formula C14H27F2OP
and a molecular weight of 280.34 g/mol. Its IUPAC name is dimethylphosphane;1-fluoro-4-(4-fluorocyclohexyl)oxycyclohexane.
Molecular Properties
| Compound Name | dimethylphosphane;1-fluoro-4-(4-fluorocyclohexyl)oxycyclohexane |
| PubChem CID | 139328560 |
| Molecular Formula | C14H27F2OP |
| Molecular Weight | 280.34 g/mol |
| Exact Mass | 280.18 |
| IUPAC Name | dimethylphosphane;1-fluoro-4-(4-fluorocyclohexyl)oxycyclohexane |
| SMILES | CPC.FC1CCC(OC2CCC(F)CC2)CC1 |
| InChI | InChI=1S/C12H20F2O.C2H7P/c13-9-1-5-11(6-2-9)15-12-7-3-10(14)4-8-12;1-3-2/h9-12H,1-8H2;3H,1-2H3 |
| InChIKey | IOIQESYKWJELFF-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.34 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze dimethylphosphane;1-fluoro-4-(4-fluorocyclohexyl)oxycyclohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethylphosphane;1-fluoro-4-(4-fluorocyclohexyl)oxycyclohexane?
The IUPAC name of dimethylphosphane;1-fluoro-4-(4-fluorocyclohexyl)oxycyclohexane (CID 139328560) is dimethylphosphane;1-fluoro-4-(4-fluorocyclohexyl)oxycyclohexane.
What is the SMILES notation for dimethylphosphane;1-fluoro-4-(4-fluorocyclohexyl)oxycyclohexane?
The canonical SMILES for dimethylphosphane;1-fluoro-4-(4-fluorocyclohexyl)oxycyclohexane is CPC.FC1CCC(OC2CCC(F)CC2)CC1.
What is the InChIKey of dimethylphosphane;1-fluoro-4-(4-fluorocyclohexyl)oxycyclohexane?
The InChIKey is IOIQESYKWJELFF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20F2O.C2H7P/c13-9-1-5-11(6-2-9)15-12-7-3-10(14)4-8-12;1-3-2/h9-12H,1-8H2;3H,1-2H3.
What are the key properties of dimethylphosphane;1-fluoro-4-(4-fluorocyclohexyl)oxycyclohexane?
dimethylphosphane;1-fluoro-4-(4-fluorocyclohexyl)oxycyclohexane has a molecular weight of 280.34 g/mol, XLogP of 4.49, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for dimethylphosphane;1-fluoro-4-(4-fluorocyclohexyl)oxycyclohexane is sourced from PubChem (CID 139328560), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).