C16H30O — CID 90160887
4-(3,4-dimethylcyclohexyl)oxy-1,2-dimethylcyclohexane (PubChem CID 90160887) has the molecular formula C16H30O and a molecular weight of 238.41 g/mol. Its IUPAC name is 4-(3,4-dimethylcyclohexyl)oxy-1,2-dimethylcyclohexane.
| Compound Name | 4-(3,4-dimethylcyclohexyl)oxy-1,2-dimethylcyclohexane |
|---|---|
| PubChem CID | 90160887 |
| Molecular Formula | C16H30O |
| Molecular Weight | 238.41 g/mol |
| Exact Mass | 238.23 |
| IUPAC Name | 4-(3,4-dimethylcyclohexyl)oxy-1,2-dimethylcyclohexane |
| SMILES | CC1CCC(OC2CCC(C)C(C)C2)CC1C |
| InChI | InChI=1S/C16H30O/c1-11-5-7-15(9-13(11)3)17-16-8-6-12(2)14(4)10-16/h11-16H,5-10H2,1-4H3 |
| InChIKey | GXEKFRXGZQHFPW-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.41 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |