C12H23NO — CID 115460446
(3S)-3-(3,4-dimethylcyclohexyl)oxypyrrolidine (PubChem CID 115460446) has the molecular formula C12H23NO and a molecular weight of 197.32 g/mol. Its IUPAC name is (3S)-3-(3,4-dimethylcyclohexyl)oxypyrrolidine.
| Compound Name | (3S)-3-(3,4-dimethylcyclohexyl)oxypyrrolidine |
|---|---|
| PubChem CID | 115460446 |
| Molecular Formula | C12H23NO |
| Molecular Weight | 197.32 g/mol |
| Exact Mass | 197.18 |
| IUPAC Name | (3S)-3-(3,4-dimethylcyclohexyl)oxypyrrolidine |
| SMILES | CC1CCC(O[C@H]2CCNC2)CC1C |
| InChI | InChI=1S/C12H23NO/c1-9-3-4-11(7-10(9)2)14-12-5-6-13-8-12/h9-13H,3-8H2,1-2H3/t9?,10?,11?,12-/m0/s1 |
| InChIKey | MNENGHSYBFSJOM-ROAFRPBMSA-N |
| XLogP | 2.19 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.32 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |