C5H8FNO — CID 135395693
(1R,4R)-7-fluoro-2-oxa-5-azabicyclo[2.2.1]heptane (PubChem CID 135395693) has the molecular formula C5H8FNO and a molecular weight of 117.12 g/mol. Its IUPAC name is (1R,4R)-7-fluoro-2-oxa-5-azabicyclo[2.2.1]heptane.
| Compound Name | (1R,4R)-7-fluoro-2-oxa-5-azabicyclo[2.2.1]heptane |
|---|---|
| PubChem CID | 135395693 |
| Molecular Formula | C5H8FNO |
| Molecular Weight | 117.12 g/mol |
| Exact Mass | 117.06 |
| IUPAC Name | (1R,4R)-7-fluoro-2-oxa-5-azabicyclo[2.2.1]heptane |
| SMILES | FC1[C@H]2CO[C@@H]1CN2 |
| InChI | InChI=1S/C5H8FNO/c6-5-3-2-8-4(5)1-7-3/h3-5,7H,1-2H2/t3-,4-,5?/m1/s1 |
| InChIKey | LRQRLXHZCIJEOH-ZZKAVYKESA-N |
| XLogP | -0.30 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 117.12 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |