C7H12FNO — CID 90236159
6-fluoro-2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b][1,4]oxazine (PubChem CID 90236159) has the molecular formula C7H12FNO and a molecular weight of 145.18 g/mol. Its IUPAC name is 6-fluoro-2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b][1,4]oxazine.
| Compound Name | 6-fluoro-2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b][1,4]oxazine |
|---|---|
| PubChem CID | 90236159 |
| Molecular Formula | C7H12FNO |
| Molecular Weight | 145.18 g/mol |
| Exact Mass | 145.09 |
| IUPAC Name | 6-fluoro-2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b][1,4]oxazine |
| SMILES | FC1CC2NCCOC2C1 |
| InChI | InChI=1S/C7H12FNO/c8-5-3-6-7(4-5)10-2-1-9-6/h5-7,9H,1-4H2 |
| InChIKey | UTUCJRXVDLBGLM-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 145.18 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |