C7H13NO2 — CID 122672123
5,9-dioxa-2-azabicyclo[6.2.0]decane (PubChem CID 122672123) has the molecular formula C7H13NO2 and a molecular weight of 143.19 g/mol. Its IUPAC name is 5,9-dioxa-2-azabicyclo[6.2.0]decane.
| Compound Name | 5,9-dioxa-2-azabicyclo[6.2.0]decane |
|---|---|
| PubChem CID | 122672123 |
| Molecular Formula | C7H13NO2 |
| Molecular Weight | 143.19 g/mol |
| Exact Mass | 143.09 |
| IUPAC Name | 5,9-dioxa-2-azabicyclo[6.2.0]decane |
| SMILES | C1COCCC2OCC2N1 |
| InChI | InChI=1S/C7H13NO2/c1-3-9-4-2-8-6-5-10-7(1)6/h6-8H,1-5H2 |
| InChIKey | QTQKKBKUCOSHLO-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 143.19 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |