C6H10FNO — CID 177267500
(1S,8R)-8-fluoro-5-oxa-2-azabicyclo[5.1.0]octane (PubChem CID 177267500) has the molecular formula C6H10FNO and a molecular weight of 131.15 g/mol. Its IUPAC name is (1S,8R)-8-fluoro-5-oxa-2-azabicyclo[5.1.0]octane.
| Compound Name | (1S,8R)-8-fluoro-5-oxa-2-azabicyclo[5.1.0]octane |
|---|---|
| PubChem CID | 177267500 |
| Molecular Formula | C6H10FNO |
| Molecular Weight | 131.15 g/mol |
| Exact Mass | 131.07 |
| IUPAC Name | (1S,8R)-8-fluoro-5-oxa-2-azabicyclo[5.1.0]octane |
| SMILES | F[C@@H]1C2COCCN[C@@H]21 |
| InChI | InChI=1S/C6H10FNO/c7-5-4-3-9-2-1-8-6(4)5/h4-6,8H,1-3H2/t4?,5-,6+/m1/s1 |
| InChIKey | OCENEDZOMLXULJ-UVCATTPVSA-N |
| XLogP | -0.06 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 131.15 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |