C7H15NO — CID 166079644
(6S)-5,6-dimethyl-1,4-oxazepane (PubChem CID 166079644) has the molecular formula C7H15NO and a molecular weight of 129.20 g/mol. Its IUPAC name is (6S)-5,6-dimethyl-1,4-oxazepane.
| Compound Name | (6S)-5,6-dimethyl-1,4-oxazepane |
|---|---|
| PubChem CID | 166079644 |
| Molecular Formula | C7H15NO |
| Molecular Weight | 129.20 g/mol |
| Exact Mass | 129.12 |
| IUPAC Name | (6S)-5,6-dimethyl-1,4-oxazepane |
| SMILES | CC1NCCOC[C@H]1C |
| InChI | InChI=1S/C7H15NO/c1-6-5-9-4-3-8-7(6)2/h6-8H,3-5H2,1-2H3/t6-,7?/m1/s1 |
| InChIKey | PWWIABCDBRNBNS-ULUSZKPHSA-N |
| XLogP | 0.63 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 129.20 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |