C6H12N2O — CID 130396612
3-methyl-7-oxa-2,5-diazabicyclo[4.2.0]octane (PubChem CID 130396612) has the molecular formula C6H12N2O and a molecular weight of 128.17 g/mol. Its IUPAC name is 3-methyl-7-oxa-2,5-diazabicyclo[4.2.0]octane.
| Compound Name | 3-methyl-7-oxa-2,5-diazabicyclo[4.2.0]octane |
|---|---|
| PubChem CID | 130396612 |
| Molecular Formula | C6H12N2O |
| Molecular Weight | 128.17 g/mol |
| Exact Mass | 128.09 |
| IUPAC Name | 3-methyl-7-oxa-2,5-diazabicyclo[4.2.0]octane |
| SMILES | CC1CNC2OCC2N1 |
| InChI | InChI=1S/C6H12N2O/c1-4-2-7-6-5(8-4)3-9-6/h4-8H,2-3H2,1H3 |
| InChIKey | LAMRHFIXNYBRRG-UHFFFAOYSA-N |
| XLogP | -0.71 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 128.17 |
| LogP ≤ 5 | -0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |