C7H11NO — CID 45092475
7-oxa-9-azatricyclo[4.2.1.02,5]nonane (PubChem CID 45092475) has the molecular formula C7H11NO and a molecular weight of 125.17 g/mol. Its IUPAC name is 7-oxa-9-azatricyclo[4.2.1.02,5]nonane.
| Compound Name | 7-oxa-9-azatricyclo[4.2.1.02,5]nonane |
|---|---|
| PubChem CID | 45092475 |
| Molecular Formula | C7H11NO |
| Molecular Weight | 125.17 g/mol |
| Exact Mass | 125.08 |
| IUPAC Name | 7-oxa-9-azatricyclo[4.2.1.02,5]nonane |
| SMILES | C1OC2NC1C1CCC21 |
| InChI | InChI=1S/C7H11NO/c1-2-5-4(1)6-3-9-7(5)8-6/h4-8H,1-3H2 |
| InChIKey | OUQPIDOELILPKQ-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 125.17 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |