C6H11NO4 — CID 74028150
6-oxa-8-azabicyclo[3.2.1]octane-2,3,4-triol (PubChem CID 74028150) has the molecular formula C6H11NO4 and a molecular weight of 161.16 g/mol. Its IUPAC name is 6-oxa-8-azabicyclo[3.2.1]octane-2,3,4-triol.
| Compound Name | 6-oxa-8-azabicyclo[3.2.1]octane-2,3,4-triol |
|---|---|
| PubChem CID | 74028150 |
| Molecular Formula | C6H11NO4 |
| Molecular Weight | 161.16 g/mol |
| Exact Mass | 161.07 |
| IUPAC Name | 6-oxa-8-azabicyclo[3.2.1]octane-2,3,4-triol |
| SMILES | OC1C2COC(N2)C(O)C1O |
| InChI | InChI=1S/C6H11NO4/c8-3-2-1-11-6(7-2)5(10)4(3)9/h2-10H,1H2 |
| InChIKey | MNVGWBSOQKTAEU-UHFFFAOYSA-N |
| XLogP | -2.60 |
| TPSA | 81.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.16 |
| LogP ≤ 5 | -2.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |