About 5-methyl-6-oxa-8-azabicyclo[3.2.1]octane-2,3,4-triol
5-methyl-6-oxa-8-azabicyclo[3.2.1]octane-2,3,4-triol (PubChem CID 85195026) has the molecular formula C7H13NO4
and a molecular weight of 175.18 g/mol. Its IUPAC name is 5-methyl-6-oxa-8-azabicyclo[3.2.1]octane-2,3,4-triol.
Analyze 5-methyl-6-oxa-8-azabicyclo[3.2.1]octane-2,3,4-triol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-6-oxa-8-azabicyclo[3.2.1]octane-2,3,4-triol?
The IUPAC name of 5-methyl-6-oxa-8-azabicyclo[3.2.1]octane-2,3,4-triol (CID 85195026) is 5-methyl-6-oxa-8-azabicyclo[3.2.1]octane-2,3,4-triol.
What is the SMILES notation for 5-methyl-6-oxa-8-azabicyclo[3.2.1]octane-2,3,4-triol?
The canonical SMILES for 5-methyl-6-oxa-8-azabicyclo[3.2.1]octane-2,3,4-triol is CC12NC(CO1)C(O)C(O)C2O.
What is the InChIKey of 5-methyl-6-oxa-8-azabicyclo[3.2.1]octane-2,3,4-triol?
The InChIKey is AXELXEKVIJRMKU-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13NO4/c1-7-6(11)5(10)4(9)3(8-7)2-12-7/h3-6,8-11H,2H2,1H3.
What are the key properties of 5-methyl-6-oxa-8-azabicyclo[3.2.1]octane-2,3,4-triol?
5-methyl-6-oxa-8-azabicyclo[3.2.1]octane-2,3,4-triol has a molecular weight of 175.18 g/mol, XLogP of -2.21, 0 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-6-oxa-8-azabicyclo[3.2.1]octane-2,3,4-triol is sourced from PubChem (CID 85195026), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).