C5H9NO2 — CID 55299693
(1S,2S,5R)-2-methoxy-3-oxa-6-azabicyclo[3.1.0]hexane (PubChem CID 55299693) has the molecular formula C5H9NO2 and a molecular weight of 115.13 g/mol. Its IUPAC name is (1S,2S,5R)-2-methoxy-3-oxa-6-azabicyclo[3.1.0]hexane.
| Compound Name | (1S,2S,5R)-2-methoxy-3-oxa-6-azabicyclo[3.1.0]hexane |
|---|---|
| PubChem CID | 55299693 |
| Molecular Formula | C5H9NO2 |
| Molecular Weight | 115.13 g/mol |
| Exact Mass | 115.06 |
| IUPAC Name | (1S,2S,5R)-2-methoxy-3-oxa-6-azabicyclo[3.1.0]hexane |
| SMILES | CO[C@H]1OC[C@@H]2N[C@H]12 |
| InChI | InChI=1S/C5H9NO2/c1-7-5-4-3(6-4)2-8-5/h3-6H,2H2,1H3/t3-,4-,5-/m0/s1 |
| InChIKey | KWPNIEIBVGRZPE-YUPRTTJUSA-N |
| XLogP | -0.67 |
| TPSA | 40.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 115.13 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|