C16H30O9 — CID 91699165
2,3,4-trimethoxy-5-[(2R,3S,4S,5R)-3,4,5-trimethoxyoxan-2-yl]oxyoxane (PubChem CID 91699165) has the molecular formula C16H30O9 and a molecular weight of 366.41 g/mol. Its IUPAC name is 2,3,4-trimethoxy-5-[(2R,3S,4S,5R)-3,4,5-trimethoxyoxan-2-yl]oxyoxane.
| Compound Name | 2,3,4-trimethoxy-5-[(2R,3S,4S,5R)-3,4,5-trimethoxyoxan-2-yl]oxyoxane |
|---|---|
| PubChem CID | 91699165 |
| Molecular Formula | C16H30O9 |
| Molecular Weight | 366.41 g/mol |
| Exact Mass | 366.19 |
| IUPAC Name | 2,3,4-trimethoxy-5-[(2R,3S,4S,5R)-3,4,5-trimethoxyoxan-2-yl]oxyoxane |
| SMILES | COC1OCC(O[C@H]2OC[C@@H](OC)[C@H](OC)[C@@H]2OC)C(OC)C1OC |
| InChI | InChI=1S/C16H30O9/c1-17-9-7-24-16(14(21-5)11(9)18-2)25-10-8-23-15(22-6)13(20-4)12(10)19-3/h9-16H,7-8H2,1-6H3/t9-,10?,11+,12?,13?,14+,15?,16-/m1/s1 |
| InChIKey | DEILOTUZCRMGNS-HHCWBCPRSA-N |
| XLogP | -0.19 |
| TPSA | 83.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.41 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |