C18H32O11 — CID 91702001
methyl 3,4,5-trimethoxy-6-[(2S,3S,4S,5R)-2,4,5-trimethoxyoxan-3-yl]oxyoxane-2-carboxylate (PubChem CID 91702001) has the molecular formula C18H32O11 and a molecular weight of 424.44 g/mol. Its IUPAC name is methyl 3,4,5-trimethoxy-6-[(2S,3S,4S,5R)-2,4,5-trimethoxyoxan-3-yl]oxyoxane-2-carboxylate.
| Compound Name | methyl 3,4,5-trimethoxy-6-[(2S,3S,4S,5R)-2,4,5-trimethoxyoxan-3-yl]oxyoxane-2-carboxylate |
|---|---|
| PubChem CID | 91702001 |
| Molecular Formula | C18H32O11 |
| Molecular Weight | 424.44 g/mol |
| Exact Mass | 424.19 |
| IUPAC Name | methyl 3,4,5-trimethoxy-6-[(2S,3S,4S,5R)-2,4,5-trimethoxyoxan-3-yl]oxyoxane-2-carboxylate |
| SMILES | COC(=O)C1OC(O[C@@H]2[C@@H](OC)OC[C@@H](OC)[C@@H]2OC)C(OC)C(OC)C1OC |
| InChI | InChI=1S/C18H32O11/c1-20-9-8-27-17(26-7)15(10(9)21-2)29-18-14(24-5)12(23-4)11(22-3)13(28-18)16(19)25-6/h9-15,17-18H,8H2,1-7H3/t9-,10+,11?,12?,13?,14?,15+,17+,18?/m1/s1 |
| InChIKey | WZHVRDBCYCYXBB-MOZUWPDASA-N |
| XLogP | -0.65 |
| TPSA | 109.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.44 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |