C34H62O19 — CID 91730717
methyl 5-[3,5-dimethoxy-6-methyl-4-[(2S,3R,4S,5R)-3,4,5-trimethoxyoxan-2-yl]oxyoxan-2-yl]oxy-3,4-dimethoxy-6-(1,3,4,5-tetramethoxypentan-2-yloxy)oxane-2-carboxylate (PubChem CID 91730717) has the molecular formula C34H62O19 and a molecular weight of 774.85 g/mol. Its IUPAC name is methyl 5-[3,5-dimethoxy-6-methyl-4-[(2S,3R,4S,5R)-3,4,5-trimethoxyoxan-2-yl]oxyoxan-2-yl]oxy-3,4-dimethoxy-6-(1,3,4,5-tetramethoxypentan-2-yloxy)oxane-2-carboxylate.
| Compound Name | methyl 5-[3,5-dimethoxy-6-methyl-4-[(2S,3R,4S,5R)-3,4,5-trimethoxyoxan-2-yl]oxyoxan-2-yl]oxy-3,4-dimethoxy-6-(1,3,4,5-tetramethoxypentan-2-yloxy)oxane-2-carboxylate |
|---|---|
| PubChem CID | 91730717 |
| Molecular Formula | C34H62O19 |
| Molecular Weight | 774.85 g/mol |
| Exact Mass | 774.39 |
| IUPAC Name | methyl 5-[3,5-dimethoxy-6-methyl-4-[(2S,3R,4S,5R)-3,4,5-trimethoxyoxan-2-yl]oxyoxan-2-yl]oxy-3,4-dimethoxy-6-(1,3,4,5-tetramethoxypentan-2-yloxy)oxane-2-carboxylate |
| SMILES | COCC(OC)C(OC)C(COC)OC1OC(C(=O)OC)C(OC)C(OC)C1OC1OC(C)C(OC)C(O[C@@H]2OC[C@@H](OC)[C@H](OC)[C@H]2OC)C1OC |
| InChI | InChI=1S/C34H62O19/c1-17-21(40-6)26(51-32-28(45-11)23(42-8)19(39-5)16-48-32)29(46-12)33(49-17)53-30-25(44-10)24(43-9)27(31(35)47-13)52-34(30)50-20(15-37-3)22(41-7)18(38-4)14-36-2/h17-30,32-34H,14-16H2,1-13H3/t17?,18?,19-,20?,21?,22?,23+,24?,25?,26?,27?,28-,29?,30?,32+,33?,34?/m1/s1 |
| InChIKey | JANWYCPGVPENQZ-NJKYKUBZSA-N |
| XLogP | -0.43 |
| TPSA | 183.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 19 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 774.85 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 19 |