C20H36O12 — CID 91699153
methyl (2R,3S,4S,5S,6S)-3,4,5-trimethoxy-6-[4,5,6-trimethoxy-2-(methoxymethyl)oxan-3-yl]oxyoxane-2-carboxylate (PubChem CID 91699153) has the molecular formula C20H36O12 and a molecular weight of 468.50 g/mol. Its IUPAC name is methyl (2R,3S,4S,5S,6S)-3,4,5-trimethoxy-6-[4,5,6-trimethoxy-2-(methoxymethyl)oxan-3-yl]oxyoxane-2-carboxylate.
| Compound Name | methyl (2R,3S,4S,5S,6S)-3,4,5-trimethoxy-6-[4,5,6-trimethoxy-2-(methoxymethyl)oxan-3-yl]oxyoxane-2-carboxylate |
|---|---|
| PubChem CID | 91699153 |
| Molecular Formula | C20H36O12 |
| Molecular Weight | 468.50 g/mol |
| Exact Mass | 468.22 |
| IUPAC Name | methyl (2R,3S,4S,5S,6S)-3,4,5-trimethoxy-6-[4,5,6-trimethoxy-2-(methoxymethyl)oxan-3-yl]oxyoxane-2-carboxylate |
| SMILES | COCC1OC(OC)C(OC)C(OC)C1O[C@H]1O[C@@H](C(=O)OC)[C@@H](OC)[C@H](OC)[C@@H]1OC |
| InChI | InChI=1S/C20H36O12/c1-22-9-10-11(12(23-2)16(26-5)19(29-8)30-10)31-20-17(27-6)14(25-4)13(24-3)15(32-20)18(21)28-7/h10-17,19-20H,9H2,1-8H3/t10?,11?,12?,13-,14-,15+,16?,17-,19?,20-/m0/s1 |
| InChIKey | OOEFSWLSEAQAKB-XMZZMSSMSA-N |
| XLogP | -0.64 |
| TPSA | 118.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.50 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |