C7H13NO5 — CID 14483110
(4E)-2-methoxy-4-methoxyiminooxane-3,5-diol (PubChem CID 14483110) has the molecular formula C7H13NO5 and a molecular weight of 191.18 g/mol. Its IUPAC name is (4E)-2-methoxy-4-methoxyiminooxane-3,5-diol.
| Compound Name | (4E)-2-methoxy-4-methoxyiminooxane-3,5-diol |
|---|---|
| PubChem CID | 14483110 |
| Molecular Formula | C7H13NO5 |
| Molecular Weight | 191.18 g/mol |
| Exact Mass | 191.08 |
| IUPAC Name | (4E)-2-methoxy-4-methoxyiminooxane-3,5-diol |
| SMILES | CO/N=C1\C(O)COC(OC)C1O |
| InChI | InChI=1S/C7H13NO5/c1-11-7-6(10)5(8-12-2)4(9)3-13-7/h4,6-7,9-10H,3H2,1-2H3/b8-5+ |
| InChIKey | GXMQZVLJDFCZSB-VMPITWQZSA-N |
| XLogP | -1.29 |
| TPSA | 80.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.18 |
| LogP ≤ 5 | -1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|