C8H14O5S — CID 174070877
S-[(3R,4S,6S)-4,5-dihydroxy-6-methoxyoxan-3-yl] ethanethioate (PubChem CID 174070877) has the molecular formula C8H14O5S and a molecular weight of 222.26 g/mol. Its IUPAC name is S-[(3R,4S,6S)-4,5-dihydroxy-6-methoxyoxan-3-yl] ethanethioate.
| Compound Name | S-[(3R,4S,6S)-4,5-dihydroxy-6-methoxyoxan-3-yl] ethanethioate |
|---|---|
| PubChem CID | 174070877 |
| Molecular Formula | C8H14O5S |
| Molecular Weight | 222.26 g/mol |
| Exact Mass | 222.06 |
| IUPAC Name | S-[(3R,4S,6S)-4,5-dihydroxy-6-methoxyoxan-3-yl] ethanethioate |
| SMILES | CO[C@H]1OC[C@@H](SC(C)=O)[C@@H](O)C1O |
| InChI | InChI=1S/C8H14O5S/c1-4(9)14-5-3-13-8(12-2)7(11)6(5)10/h5-8,10-11H,3H2,1-2H3/t5-,6-,7?,8+/m1/s1 |
| InChIKey | BZISECMJJQETBQ-UQYSTIMWSA-N |
| XLogP | -0.64 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.26 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|