C8H15NO4 — CID 90089730
(3R,4E,6R)-2-methoxy-4-methoxyimino-6-methyloxan-3-ol (PubChem CID 90089730) has the molecular formula C8H15NO4 and a molecular weight of 189.21 g/mol. Its IUPAC name is (3R,4E,6R)-2-methoxy-4-methoxyimino-6-methyloxan-3-ol.
| Compound Name | (3R,4E,6R)-2-methoxy-4-methoxyimino-6-methyloxan-3-ol |
|---|---|
| PubChem CID | 90089730 |
| Molecular Formula | C8H15NO4 |
| Molecular Weight | 189.21 g/mol |
| Exact Mass | 189.10 |
| IUPAC Name | (3R,4E,6R)-2-methoxy-4-methoxyimino-6-methyloxan-3-ol |
| SMILES | CO/N=C1\C[C@@H](C)OC(OC)[C@@H]1O |
| InChI | InChI=1S/C8H15NO4/c1-5-4-6(9-12-3)7(10)8(11-2)13-5/h5,7-8,10H,4H2,1-3H3/b9-6+/t5-,7-,8?/m1/s1 |
| InChIKey | DRXHSHPNDYDFHL-FGVNQJLSSA-N |
| XLogP | 0.13 |
| TPSA | 60.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.21 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|