C8H14INO2 — CID 142521463
(E,2R,6R)-2-(iodomethyl)-N-methoxy-6-methyloxan-4-imine (PubChem CID 142521463) has the molecular formula C8H14INO2 and a molecular weight of 283.11 g/mol. Its IUPAC name is (E,2R,6R)-2-(iodomethyl)-N-methoxy-6-methyloxan-4-imine.
| Compound Name | (E,2R,6R)-2-(iodomethyl)-N-methoxy-6-methyloxan-4-imine |
|---|---|
| PubChem CID | 142521463 |
| Molecular Formula | C8H14INO2 |
| Molecular Weight | 283.11 g/mol |
| Exact Mass | 283.01 |
| IUPAC Name | (E,2R,6R)-2-(iodomethyl)-N-methoxy-6-methyloxan-4-imine |
| SMILES | CO/N=C1/C[C@H](CI)O[C@H](C)C1 |
| InChI | InChI=1S/C8H14INO2/c1-6-3-7(10-11-2)4-8(5-9)12-6/h6,8H,3-5H2,1-2H3/b10-7+/t6-,8-/m1/s1 |
| InChIKey | VRFVQVIMQOXRJW-IMUDWZADSA-N |
| XLogP | 1.99 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.11 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|