C14H19NO4 — CID 11054569
(2S,3S,4E,6S)-6-methoxy-2-methyl-4-phenylmethoxyiminooxan-3-ol (PubChem CID 11054569) has the molecular formula C14H19NO4 and a molecular weight of 265.31 g/mol. Its IUPAC name is (2S,3S,4E,6S)-6-methoxy-2-methyl-4-phenylmethoxyiminooxan-3-ol.
| Compound Name | (2S,3S,4E,6S)-6-methoxy-2-methyl-4-phenylmethoxyiminooxan-3-ol |
|---|---|
| PubChem CID | 11054569 |
| Molecular Formula | C14H19NO4 |
| Molecular Weight | 265.31 g/mol |
| Exact Mass | 265.13 |
| IUPAC Name | (2S,3S,4E,6S)-6-methoxy-2-methyl-4-phenylmethoxyiminooxan-3-ol |
| SMILES | CO[C@@H]1C/C(=N\OCc2ccccc2)[C@H](O)[C@H](C)O1 |
| InChI | InChI=1S/C14H19NO4/c1-10-14(16)12(8-13(17-2)19-10)15-18-9-11-6-4-3-5-7-11/h3-7,10,13-14,16H,8-9H2,1-2H3/b15-12+/t10-,13-,14+/m0/s1 |
| InChIKey | GEHMPPHHODTFJU-WFHMKTEYSA-N |
| XLogP | 1.70 |
| TPSA | 60.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.31 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|