C8H16O3 — CID 143625377
(2R,3R)-2,3-dimethoxy-6-methyloxane (PubChem CID 143625377) has the molecular formula C8H16O3 and a molecular weight of 160.21 g/mol. Its IUPAC name is (2R,3R)-2,3-dimethoxy-6-methyloxane.
| Compound Name | (2R,3R)-2,3-dimethoxy-6-methyloxane |
|---|---|
| PubChem CID | 143625377 |
| Molecular Formula | C8H16O3 |
| Molecular Weight | 160.21 g/mol |
| Exact Mass | 160.11 |
| IUPAC Name | (2R,3R)-2,3-dimethoxy-6-methyloxane |
| SMILES | CO[C@@H]1OC(C)CC[C@H]1OC |
| InChI | InChI=1S/C8H16O3/c1-6-4-5-7(9-2)8(10-3)11-6/h6-8H,4-5H2,1-3H3/t6?,7-,8-/m1/s1 |
| InChIKey | ORJWUTOTXPNDED-SPDVFEMOSA-N |
| XLogP | 1.17 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.21 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |