C10H22O3 — CID 145337988
3,6-dimethoxy-2-methyloxane;ethane (PubChem CID 145337988) has the molecular formula C10H22O3 and a molecular weight of 190.28 g/mol. Its IUPAC name is 3,6-dimethoxy-2-methyloxane;ethane.
| Compound Name | 3,6-dimethoxy-2-methyloxane;ethane |
|---|---|
| PubChem CID | 145337988 |
| Molecular Formula | C10H22O3 |
| Molecular Weight | 190.28 g/mol |
| Exact Mass | 190.16 |
| IUPAC Name | 3,6-dimethoxy-2-methyloxane;ethane |
| SMILES | CC.COC1CCC(OC)C(C)O1 |
| InChI | InChI=1S/C8H16O3.C2H6/c1-6-7(9-2)4-5-8(10-3)11-6;1-2/h6-8H,4-5H2,1-3H3;1-2H3 |
| InChIKey | BHEXMIYGIIMXFV-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.28 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |