C10H23NO4 — CID 176998974
(2S,3R,6R)-6-methoxy-2-methyloxan-3-amine;propane-2,2-diol (PubChem CID 176998974) has the molecular formula C10H23NO4 and a molecular weight of 221.30 g/mol. Its IUPAC name is (2S,3R,6R)-6-methoxy-2-methyloxan-3-amine;propane-2,2-diol.
| Compound Name | (2S,3R,6R)-6-methoxy-2-methyloxan-3-amine;propane-2,2-diol |
|---|---|
| PubChem CID | 176998974 |
| Molecular Formula | C10H23NO4 |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.16 |
| IUPAC Name | (2S,3R,6R)-6-methoxy-2-methyloxan-3-amine;propane-2,2-diol |
| SMILES | CC(C)(O)O.CO[C@H]1CC[C@@H](N)[C@H](C)O1 |
| InChI | InChI=1S/C7H15NO2.C3H8O2/c1-5-6(8)3-4-7(9-2)10-5;1-3(2,4)5/h5-7H,3-4,8H2,1-2H3;4-5H,1-2H3/t5-,6+,7+;/m0./s1 |
| InChIKey | GAOHKSRAZVMXMK-VWZUFWLJSA-N |
| XLogP | 0.19 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|