C9H20O3 — CID 144590904
ethane;(2R,3R,6R)-3-methoxy-6-methyloxan-2-ol (PubChem CID 144590904) has the molecular formula C9H20O3 and a molecular weight of 176.26 g/mol. Its IUPAC name is ethane;(2R,3R,6R)-3-methoxy-6-methyloxan-2-ol.
| Compound Name | ethane;(2R,3R,6R)-3-methoxy-6-methyloxan-2-ol |
|---|---|
| PubChem CID | 144590904 |
| Molecular Formula | C9H20O3 |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.14 |
| IUPAC Name | ethane;(2R,3R,6R)-3-methoxy-6-methyloxan-2-ol |
| SMILES | CC.CO[C@@H]1CC[C@@H](C)O[C@H]1O |
| InChI | InChI=1S/C7H14O3.C2H6/c1-5-3-4-6(9-2)7(8)10-5;1-2/h5-8H,3-4H2,1-2H3;1-2H3/t5-,6-,7-;/m1./s1 |
| InChIKey | RDEZBUCMDQIWRZ-RYLOHDEPSA-N |
| XLogP | 1.54 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |