C6H9N — CID 163720320
(4S)-3-azatricyclo[3.2.0.02,4]heptane (PubChem CID 163720320) has the molecular formula C6H9N and a molecular weight of 95.15 g/mol. Its IUPAC name is (4S)-3-azatricyclo[3.2.0.02,4]heptane.
| Compound Name | (4S)-3-azatricyclo[3.2.0.02,4]heptane |
|---|---|
| PubChem CID | 163720320 |
| Molecular Formula | C6H9N |
| Molecular Weight | 95.15 g/mol |
| Exact Mass | 95.07 |
| IUPAC Name | (4S)-3-azatricyclo[3.2.0.02,4]heptane |
| SMILES | C1CC2C1C1N[C@@H]21 |
| InChI | InChI=1S/C6H9N/c1-2-4-3(1)5-6(4)7-5/h3-7H,1-2H2/t3?,4?,5-,6?/m0/s1 |
| InChIKey | KQZLJBRAOHMABS-CTQIIAAMSA-N |
| XLogP | 0.37 |
| TPSA | 21.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 95.15 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|