C18H32F2O — CID 140565841
1-(4-butylcyclohexyl)-4-ethoxy-2,3-difluorocyclohexane (PubChem CID 140565841) has the molecular formula C18H32F2O and a molecular weight of 302.45 g/mol. Its IUPAC name is 1-(4-butylcyclohexyl)-4-ethoxy-2,3-difluorocyclohexane.
| Compound Name | 1-(4-butylcyclohexyl)-4-ethoxy-2,3-difluorocyclohexane |
|---|---|
| PubChem CID | 140565841 |
| Molecular Formula | C18H32F2O |
| Molecular Weight | 302.45 g/mol |
| Exact Mass | 302.24 |
| IUPAC Name | 1-(4-butylcyclohexyl)-4-ethoxy-2,3-difluorocyclohexane |
| SMILES | CCCCC1CCC(C2CCC(OCC)C(F)C2F)CC1 |
| InChI | InChI=1S/C18H32F2O/c1-3-5-6-13-7-9-14(10-8-13)15-11-12-16(21-4-2)18(20)17(15)19/h13-18H,3-12H2,1-2H3 |
| InChIKey | KRWDTHWJFUVJEU-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.45 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |