C16H26F2O — CID 20645957
2,3-difluoro-1-(4-methylcyclohexyl)-4-prop-1-en-2-yloxycyclohexane (PubChem CID 20645957) has the molecular formula C16H26F2O and a molecular weight of 272.38 g/mol. Its IUPAC name is 2,3-difluoro-1-(4-methylcyclohexyl)-4-prop-1-en-2-yloxycyclohexane.
| Compound Name | 2,3-difluoro-1-(4-methylcyclohexyl)-4-prop-1-en-2-yloxycyclohexane |
|---|---|
| PubChem CID | 20645957 |
| Molecular Formula | C16H26F2O |
| Molecular Weight | 272.38 g/mol |
| Exact Mass | 272.20 |
| IUPAC Name | 2,3-difluoro-1-(4-methylcyclohexyl)-4-prop-1-en-2-yloxycyclohexane |
| SMILES | C=C(C)OC1CCC(C2CCC(C)CC2)C(F)C1F |
| InChI | InChI=1S/C16H26F2O/c1-10(2)19-14-9-8-13(15(17)16(14)18)12-6-4-11(3)5-7-12/h11-16H,1,4-9H2,2-3H3 |
| InChIKey | IEAHMKVYIJTRDJ-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.38 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|